C10H13FN2O4S3 — CID 82016244
5-fluoro-2-(2-methylsulfonylethylsulfonylamino)benzenecarbothioamide (PubChem CID 82016244) has the molecular formula C10H13FN2O4S3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-fluoro-2-(2-methylsulfonylethylsulfonylamino)benzenecarbothioamide.
| Compound Name | 5-fluoro-2-(2-methylsulfonylethylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 82016244 |
| Molecular Formula | C10H13FN2O4S3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 5-fluoro-2-(2-methylsulfonylethylsulfonylamino)benzenecarbothioamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C10H13FN2O4S3/c1-19(14,15)4-5-20(16,17)13-9-3-2-7(11)6-8(9)10(12)18/h2-3,6,13H,4-5H2,1H3,(H2,12,18) |
| InChIKey | XHWGFUGZLPMONL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|