C9H12FN3O2S2 — CID 114808511
2-(ethylsulfamoylamino)-5-fluorobenzenecarbothioamide (PubChem CID 114808511) has the molecular formula C9H12FN3O2S2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(ethylsulfamoylamino)-5-fluorobenzenecarbothioamide.
| Compound Name | 2-(ethylsulfamoylamino)-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 114808511 |
| Molecular Formula | C9H12FN3O2S2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-(ethylsulfamoylamino)-5-fluorobenzenecarbothioamide |
| SMILES | CCNS(=O)(=O)Nc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C9H12FN3O2S2/c1-2-12-17(14,15)13-8-4-3-6(10)5-7(8)9(11)16/h3-5,12-13H,2H2,1H3,(H2,11,16) |
| InChIKey | YEWVUEOHGMANQZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|