C11H10ClFN4O2S2 — CID 106314594
2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-fluorobenzenecarbothioamide (PubChem CID 106314594) has the molecular formula C11H10ClFN4O2S2 and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106314594 |
| Molecular Formula | C11H10ClFN4O2S2 |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-fluorobenzenecarbothioamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)Nc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C11H10ClFN4O2S2/c1-17-11(8(12)5-15-17)21(18,19)16-9-3-2-6(13)4-7(9)10(14)20/h2-5,16H,1H3,(H2,14,20) |
| InChIKey | ZNEVDDPAIMLXQI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|