C11H14FN3O4S2 — CID 114463692
propan-2-yl N-[(2-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate (PubChem CID 114463692) has the molecular formula C11H14FN3O4S2 and a molecular weight of 335.38 g/mol. Its IUPAC name is propan-2-yl N-[(2-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(2-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463692 |
| Molecular Formula | C11H14FN3O4S2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | propan-2-yl N-[(2-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)Nc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C11H14FN3O4S2/c1-6(2)19-11(16)15-21(17,18)14-9-4-3-7(12)5-8(9)10(13)20/h3-6,14H,1-2H3,(H2,13,20)(H,15,16) |
| InChIKey | UWIDHHUSOLKKED-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|