C9H10FN3O4S2 — CID 114463601
methyl N-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate (PubChem CID 114463601) has the molecular formula C9H10FN3O4S2 and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl N-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463601 |
| Molecular Formula | C9H10FN3O4S2 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | methyl N-[(3-carbamothioyl-4-fluorophenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C9H10FN3O4S2/c1-17-9(14)13-19(15,16)12-5-2-3-7(10)6(4-5)8(11)18/h2-4,12H,1H3,(H2,11,18)(H,13,14) |
| InChIKey | RFENBLUGHFUYIF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|