C8H10FN3O4S — CID 114461484
methyl N-[(5-amino-2-fluorophenyl)sulfamoyl]carbamate (PubChem CID 114461484) has the molecular formula C8H10FN3O4S and a molecular weight of 263.25 g/mol. Its IUPAC name is methyl N-[(5-amino-2-fluorophenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(5-amino-2-fluorophenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461484 |
| Molecular Formula | C8H10FN3O4S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | methyl N-[(5-amino-2-fluorophenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1cc(N)ccc1F |
| InChI | InChI=1S/C8H10FN3O4S/c1-16-8(13)12-17(14,15)11-7-4-5(10)2-3-6(7)9/h2-4,11H,10H2,1H3,(H,12,13) |
| InChIKey | LIQFUZBPJVTBIF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|