C12H18FN3O4S — CID 86680228
tert-butyl N-[(4-amino-2-fluorophenyl)methylsulfamoyl]carbamate (PubChem CID 86680228) has the molecular formula C12H18FN3O4S and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl N-[(4-amino-2-fluorophenyl)methylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[(4-amino-2-fluorophenyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 86680228 |
| Molecular Formula | C12H18FN3O4S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | tert-butyl N-[(4-amino-2-fluorophenyl)methylsulfamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCc1ccc(N)cc1F |
| InChI | InChI=1S/C12H18FN3O4S/c1-12(2,3)20-11(17)16-21(18,19)15-7-8-4-5-9(14)6-10(8)13/h4-6,15H,7,14H2,1-3H3,(H,16,17) |
| InChIKey | SYWSESPHIFFZJG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|