C7H13F3N2O4S — CID 155097174
tert-butyl N-(2,2,2-trifluoroethylsulfamoyl)carbamate (PubChem CID 155097174) has the molecular formula C7H13F3N2O4S and a molecular weight of 278.25 g/mol. Its IUPAC name is tert-butyl N-(2,2,2-trifluoroethylsulfamoyl)carbamate.
| Compound Name | tert-butyl N-(2,2,2-trifluoroethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 155097174 |
| Molecular Formula | C7H13F3N2O4S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | tert-butyl N-(2,2,2-trifluoroethylsulfamoyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O4S/c1-6(2,3)16-5(13)12-17(14,15)11-4-7(8,9)10/h11H,4H2,1-3H3,(H,12,13) |
| InChIKey | BKZCZNMPRNSQBF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |