methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate

C5H9F3N2O4S — CID 114811439

IUPACmethyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate
SMILESCOC(=O)CNS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C5H9F3N2O4S/c1-14-4(11)2-9-15(12,13)10-3-5(6,7)8/h9-10H,2-3H2,1H3
InChIKeyPBOWKTUDKWNSNP-UHFFFAOYSA-N
MW250.20 g/mol
LogP-0.85
Rot. Bonds5

About methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate

methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate (PubChem CID 114811439) has the molecular formula C5H9F3N2O4S and a molecular weight of 250.20 g/mol. Its IUPAC name is methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate.

Molecular Properties

Compound Namemethyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate
PubChem CID114811439
Molecular FormulaC5H9F3N2O4S
Molecular Weight250.20 g/mol
Exact Mass250.02
IUPAC Namemethyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate
SMILESCOC(=O)CNS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C5H9F3N2O4S/c1-14-4(11)2-9-15(12,13)10-3-5(6,7)8/h9-10H,2-3H2,1H3
InChIKeyPBOWKTUDKWNSNP-UHFFFAOYSA-N
XLogP-0.85
TPSA84.50 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.20
LogP ≤ 5-0.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate?
The IUPAC name of methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate (CID 114811439) is methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate.
What is the SMILES notation for methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate?
The canonical SMILES for methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate is COC(=O)CNS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate?
The InChIKey is PBOWKTUDKWNSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F3N2O4S/c1-14-4(11)2-9-15(12,13)10-3-5(6,7)8/h9-10H,2-3H2,1H3.
What are the key properties of methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate?
methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate has a molecular weight of 250.20 g/mol, XLogP of -0.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate is sourced from PubChem (CID 114811439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).