C5H9F3N2O4S — CID 114811439
methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate (PubChem CID 114811439) has the molecular formula C5H9F3N2O4S and a molecular weight of 250.20 g/mol. Its IUPAC name is methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate.
| Compound Name | methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate |
|---|---|
| PubChem CID | 114811439 |
| Molecular Formula | C5H9F3N2O4S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | methyl 2-(2,2,2-trifluoroethylsulfamoylamino)acetate |
| SMILES | COC(=O)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H9F3N2O4S/c1-14-4(11)2-9-15(12,13)10-3-5(6,7)8/h9-10H,2-3H2,1H3 |
| InChIKey | PBOWKTUDKWNSNP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |