C8H17N3O6S — CID 10016675
methyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoylamino]acetate (PubChem CID 10016675) has the molecular formula C8H17N3O6S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoylamino]acetate.
| Compound Name | methyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoylamino]acetate |
|---|---|
| PubChem CID | 10016675 |
| Molecular Formula | C8H17N3O6S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]sulfamoylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H17N3O6S/c1-8(2,3)17-7(13)10-11-18(14,15)9-5-6(12)16-4/h9,11H,5H2,1-4H3,(H,10,13) |
| InChIKey | GQFUKHSCRKGVDG-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|