C11H14Cl2N2O4S — CID 8500966
tert-butyl N-[(2,3-dichlorophenyl)sulfonylamino]carbamate (PubChem CID 8500966) has the molecular formula C11H14Cl2N2O4S and a molecular weight of 341.22 g/mol. Its IUPAC name is tert-butyl N-[(2,3-dichlorophenyl)sulfonylamino]carbamate.
| Compound Name | tert-butyl N-[(2,3-dichlorophenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8500966 |
| Molecular Formula | C11H14Cl2N2O4S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | tert-butyl N-[(2,3-dichlorophenyl)sulfonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2N2O4S/c1-11(2,3)19-10(16)14-15-20(17,18)8-6-4-5-7(12)9(8)13/h4-6,15H,1-3H3,(H,14,16) |
| InChIKey | ITHUTJLEMJRJKK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|