C11H15ClN2O4S — CID 8500976
tert-butyl N-[(2-chlorophenyl)sulfonylamino]carbamate (PubChem CID 8500976) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is tert-butyl N-[(2-chlorophenyl)sulfonylamino]carbamate.
| Compound Name | tert-butyl N-[(2-chlorophenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8500976 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | tert-butyl N-[(2-chlorophenyl)sulfonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H15ClN2O4S/c1-11(2,3)18-10(15)13-14-19(16,17)9-7-5-4-6-8(9)12/h4-7,14H,1-3H3,(H,13,15) |
| InChIKey | ZJWYSVJMDIANMI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|