C16H22ClNO6S — CID 53241185
[(2-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2-dimethylpropanoate (PubChem CID 53241185) has the molecular formula C16H22ClNO6S and a molecular weight of 391.87 g/mol. Its IUPAC name is [(2-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2-dimethylpropanoate.
| Compound Name | [(2-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53241185 |
| Molecular Formula | C16H22ClNO6S |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [(2-chlorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)N(OC(=O)C(C)(C)C)S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClNO6S/c1-15(2,3)13(19)24-18(14(20)23-16(4,5)6)25(21,22)12-10-8-7-9-11(12)17/h7-10H,1-6H3 |
| InChIKey | ISIVBSWCUMHYPV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|