C17H25N3O8S2 — CID 87312161
[(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] piperazine-1-carboxylate (PubChem CID 87312161) has the molecular formula C17H25N3O8S2 and a molecular weight of 463.53 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] piperazine-1-carboxylate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87312161 |
| Molecular Formula | C17H25N3O8S2 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(OC(=O)N1CCNCC1)S(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C17H25N3O8S2/c1-17(2,3)27-16(22)20(28-15(21)19-11-9-18-10-12-19)30(25,26)14-8-6-5-7-13(14)29(4,23)24/h5-8,18H,9-12H2,1-4H3 |
| InChIKey | LICOMKPXSBIWRW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|