C16H25ClN3NaO4S — CID 87877953
sodium;tert-butyl piperazine-1-carboxylate;chloro-(4-methylphenyl)sulfonylazanide (PubChem CID 87877953) has the molecular formula C16H25ClN3NaO4S and a molecular weight of 413.90 g/mol. Its IUPAC name is sodium;tert-butyl piperazine-1-carboxylate;chloro-(4-methylphenyl)sulfonylazanide.
| Compound Name | sodium;tert-butyl piperazine-1-carboxylate;chloro-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 87877953 |
| Molecular Formula | C16H25ClN3NaO4S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | sodium;tert-butyl piperazine-1-carboxylate;chloro-(4-methylphenyl)sulfonylazanide |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+] |
| InChI | InChI=1S/C9H18N2O2.C7H7ClNO2S.Na/c1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-6-2-4-7(5-3-6)12(10,11)9-8;/h10H,4-7H2,1-3H3;2-5H,1H3;/q;-1;+1 |
| InChIKey | DZHMQHWNUKZDQM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |