C17H25N3O4S — CID 175856555
tert-butyl 4-[(4-methylphenyl)sulfonyliminomethyl]piperazine-1-carboxylate (PubChem CID 175856555) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is tert-butyl 4-[(4-methylphenyl)sulfonyliminomethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-methylphenyl)sulfonyliminomethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175856555 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | tert-butyl 4-[(4-methylphenyl)sulfonyliminomethyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N=CN2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-14-5-7-15(8-6-14)25(22,23)18-13-19-9-11-20(12-10-19)16(21)24-17(2,3)4/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | ZCJUXJONHODPFL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|