C23H30N4O2S — CID 166935619
tert-butyl 4-[2-[(E)-[(4-methylphenyl)sulfanylhydrazinylidene]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 166935619) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is tert-butyl 4-[2-[(E)-[(4-methylphenyl)sulfanylhydrazinylidene]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(E)-[(4-methylphenyl)sulfanylhydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166935619 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | tert-butyl 4-[2-[(E)-[(4-methylphenyl)sulfanylhydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(SN/N=C/c2ccccc2N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O2S/c1-18-9-11-20(12-10-18)30-25-24-17-19-7-5-6-8-21(19)26-13-15-27(16-14-26)22(28)29-23(2,3)4/h5-12,17,25H,13-16H2,1-4H3/b24-17+ |
| InChIKey | CCYFRZSJIGZLBW-JJIBRWJFSA-N |
| XLogP | 4.68 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|