C16H26N6O2 — CID 142156540
tert-butyl 4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazine-1-carboxylate (PubChem CID 142156540) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl 4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142156540 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl 4-[2-[(Z)-N'-hydrazinylcarbamimidoyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2/C(N)=N/NN)CC1 |
| InChI | InChI=1S/C16H26N6O2/c1-16(2,3)24-15(23)22-10-8-21(9-11-22)13-7-5-4-6-12(13)14(17)19-20-18/h4-7,20H,8-11,18H2,1-3H3,(H2,17,19) |
| InChIKey | AICFIIBMLKBWAS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|