C20H33N3O5S — CID 18436785
tert-butyl 4-[2-[2-(methanesulfonamido)-2-methylpropoxy]phenyl]piperazine-1-carboxylate (PubChem CID 18436785) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(methanesulfonamido)-2-methylpropoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(methanesulfonamido)-2-methylpropoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18436785 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl 4-[2-[2-(methanesulfonamido)-2-methylpropoxy]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(COc1ccccc1N1CCN(C(=O)OC(C)(C)C)CC1)NS(C)(=O)=O |
| InChI | InChI=1S/C20H33N3O5S/c1-19(2,3)28-18(24)23-13-11-22(12-14-23)16-9-7-8-10-17(16)27-15-20(4,5)21-29(6,25)26/h7-10,21H,11-15H2,1-6H3 |
| InChIKey | APPZUZZQFRGRFG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |