C21H35N3O4S — CID 69411084
tert-butyl 4-[2-[3-methylbutyl(methylsulfonyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 69411084) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-methylbutyl(methylsulfonyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-methylbutyl(methylsulfonyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69411084 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl 4-[2-[3-methylbutyl(methylsulfonyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)CCN(c1ccccc1N1CCN(C(=O)OC(C)(C)C)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C21H35N3O4S/c1-17(2)11-12-24(29(6,26)27)19-10-8-7-9-18(19)22-13-15-23(16-14-22)20(25)28-21(3,4)5/h7-10,17H,11-16H2,1-6H3 |
| InChIKey | QYQYDYHAGHRAHI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |