C14H22N3O3+ — CID 58736710
tert-butyl 4-(1-hydroxypyridin-1-ium-2-yl)piperazine-1-carboxylate (PubChem CID 58736710) has the molecular formula C14H22N3O3+ and a molecular weight of 280.35 g/mol. Its IUPAC name is tert-butyl 4-(1-hydroxypyridin-1-ium-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-hydroxypyridin-1-ium-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58736710 |
| Molecular Formula | C14H22N3O3+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | tert-butyl 4-(1-hydroxypyridin-1-ium-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc[n+]2O)CC1 |
| InChI | InChI=1S/C14H22N3O3/c1-14(2,3)20-13(18)16-10-8-15(9-11-16)12-6-4-5-7-17(12)19/h4-7,19H,8-11H2,1-3H3/q+1 |
| InChIKey | UGIKLIXCEUQARF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|