C21H33N3O3 — CID 142942011
tert-butyl 4-[2-[[acetyl(propyl)amino]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 142942011) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is tert-butyl 4-[2-[[acetyl(propyl)amino]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[acetyl(propyl)amino]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142942011 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | tert-butyl 4-[2-[[acetyl(propyl)amino]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CCCN(Cc1ccccc1N1CCN(C(=O)OC(C)(C)C)CC1)C(C)=O |
| InChI | InChI=1S/C21H33N3O3/c1-6-11-24(17(2)25)16-18-9-7-8-10-19(18)22-12-14-23(15-13-22)20(26)27-21(3,4)5/h7-10H,6,11-16H2,1-5H3 |
| InChIKey | SAWMAPAGCOEZLV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |