C22H33N5O2 — CID 58996662
tert-butyl 4-[2-[(4-tert-butyltriazol-1-yl)methyl]phenyl]piperazine-1-carboxylate (PubChem CID 58996662) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-tert-butyltriazol-1-yl)methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-tert-butyltriazol-1-yl)methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58996662 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | tert-butyl 4-[2-[(4-tert-butyltriazol-1-yl)methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2Cn2cc(C(C)(C)C)nn2)CC1 |
| InChI | InChI=1S/C22H33N5O2/c1-21(2,3)19-16-27(24-23-19)15-17-9-7-8-10-18(17)25-11-13-26(14-12-25)20(28)29-22(4,5)6/h7-10,16H,11-15H2,1-6H3 |
| InChIKey | NBGPNPHVUDFOEF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |