C17H27N3O4S — CID 69410613
tert-butyl 4-[2-(ethylsulfonylamino)phenyl]piperazine-1-carboxylate (PubChem CID 69410613) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(ethylsulfonylamino)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(ethylsulfonylamino)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69410613 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl 4-[2-(ethylsulfonylamino)phenyl]piperazine-1-carboxylate |
| SMILES | CCS(=O)(=O)Nc1ccccc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H27N3O4S/c1-5-25(22,23)18-14-8-6-7-9-15(14)19-10-12-20(13-11-19)16(21)24-17(2,3)4/h6-9,18H,5,10-13H2,1-4H3 |
| InChIKey | TXJQDACRCOBHNX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |