C27H44N4O6 — CID 90774252
tert-butyl 4-[[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-(3-methylbutyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 90774252) has the molecular formula C27H44N4O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl 4-[[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-(3-methylbutyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-(3-methylbutyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90774252 |
| Molecular Formula | C27H44N4O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | tert-butyl 4-[[2-(2,3-dihydroxyphenyl)ethyl-propylcarbamoyl]-(3-methylbutyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | CCCN(CCc1cccc(O)c1O)C(=O)N(CCC(C)C)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H44N4O6/c1-7-13-28(14-12-21-9-8-10-22(32)23(21)33)24(34)31(15-11-20(2)3)25(35)29-16-18-30(19-17-29)26(36)37-27(4,5)6/h8-10,20,32-33H,7,11-19H2,1-6H3 |
| InChIKey | WMZBBXHBPVDZRG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|