C19H26ClNO4 — CID 138563026
tert-butyl (3aS,6aR)-5-[(2-chloro-3-hydroxyphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 138563026) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[(2-chloro-3-hydroxyphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[(2-chloro-3-hydroxyphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 138563026 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[(2-chloro-3-hydroxyphenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(OCc3cccc(O)c3Cl)C[C@H]2C1 |
| InChI | InChI=1S/C19H26ClNO4/c1-19(2,3)25-18(23)21-9-13-7-15(8-14(13)10-21)24-11-12-5-4-6-16(22)17(12)20/h4-6,13-15,22H,7-11H2,1-3H3/t13-,14+,15? |
| InChIKey | MKLJKSPUYAARTI-YIONKMFJSA-N |
| XLogP | 4.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |