C14H22N6O3 — CID 175623819
tert-butyl 4-[6-(N'-hydroxycarbamimidoyl)pyridazin-3-yl]piperazine-1-carboxylate (PubChem CID 175623819) has the molecular formula C14H22N6O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl 4-[6-(N'-hydroxycarbamimidoyl)pyridazin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(N'-hydroxycarbamimidoyl)pyridazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175623819 |
| Molecular Formula | C14H22N6O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl 4-[6-(N'-hydroxycarbamimidoyl)pyridazin-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(N)=NO)nn2)CC1 |
| InChI | InChI=1S/C14H22N6O3/c1-14(2,3)23-13(21)20-8-6-19(7-9-20)11-5-4-10(16-17-11)12(15)18-22/h4-5,22H,6-9H2,1-3H3,(H2,15,18) |
| InChIKey | VXZBPJGZGUNKHF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|