C17H30N4O3 — CID 145279147
tert-butyl 4-(5-amino-6-methoxy-2-pyridinyl)piperazine-1-carboxylate;ethane (PubChem CID 145279147) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-6-methoxy-2-pyridinyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(5-amino-6-methoxy-2-pyridinyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145279147 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | tert-butyl 4-(5-amino-6-methoxy-2-pyridinyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.COc1nc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C15H24N4O3.C2H6/c1-15(2,3)22-14(20)19-9-7-18(8-10-19)12-6-5-11(16)13(17-12)21-4;1-2/h5-6H,7-10,16H2,1-4H3;1-2H3 |
| InChIKey | HLASFGDMEQEZBQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |