C19H32N6O4 — CID 168833409
tert-butyl 4-[2-[2-(dimethylamino)ethoxy]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]piperazine-1-carboxylate (PubChem CID 168833409) has the molecular formula C19H32N6O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(dimethylamino)ethoxy]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(dimethylamino)ethoxy]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168833409 |
| Molecular Formula | C19H32N6O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | tert-butyl 4-[2-[2-(dimethylamino)ethoxy]-6-[(Z)-N'-hydroxycarbamimidoyl]-4-pyridinyl]piperazine-1-carboxylate |
| SMILES | CN(C)CCOc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C19H32N6O4/c1-19(2,3)29-18(26)25-8-6-24(7-9-25)14-12-15(17(20)22-27)21-16(13-14)28-11-10-23(4)5/h12-13,27H,6-11H2,1-5H3,(H2,20,22) |
| InChIKey | UKEFMRSJTGIGDG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|