C24H41N7O4 — CID 168833428
tert-butyl 4-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-[(2S)-4-(2-methoxyethyl)-2-methyl-1,4-diazepan-1-yl]-4-pyridinyl]piperazine-1-carboxylate (PubChem CID 168833428) has the molecular formula C24H41N7O4 and a molecular weight of 491.64 g/mol. Its IUPAC name is tert-butyl 4-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-[(2S)-4-(2-methoxyethyl)-2-methyl-1,4-diazepan-1-yl]-4-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-[(2S)-4-(2-methoxyethyl)-2-methyl-1,4-diazepan-1-yl]-4-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168833428 |
| Molecular Formula | C24H41N7O4 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | tert-butyl 4-[2-[(Z)-N'-hydroxycarbamimidoyl]-6-[(2S)-4-(2-methoxyethyl)-2-methyl-1,4-diazepan-1-yl]-4-pyridinyl]piperazine-1-carboxylate |
| SMILES | COCCN1CCCN(c2cc(N3CCN(C(=O)OC(C)(C)C)CC3)cc(/C(N)=N/O)n2)[C@@H](C)C1 |
| InChI | InChI=1S/C24H41N7O4/c1-18-17-28(13-14-34-5)7-6-8-31(18)21-16-19(15-20(26-21)22(25)27-33)29-9-11-30(12-10-29)23(32)35-24(2,3)4/h15-16,18,33H,6-14,17H2,1-5H3,(H2,25,27)/t18-/m0/s1 |
| InChIKey | DFRPBOWADBHOLR-SFHVURJKSA-N |
| XLogP | 1.78 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|