C24H41N9O3 — CID 168833573
tert-butyl 4-[1-[2-[(2S)-2,4-dimethyl-1,4-diazepan-1-yl]-6-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-4-yl]azetidin-3-yl]piperazine-1-carboxylate (PubChem CID 168833573) has the molecular formula C24H41N9O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-[(2S)-2,4-dimethyl-1,4-diazepan-1-yl]-6-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-4-yl]azetidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[2-[(2S)-2,4-dimethyl-1,4-diazepan-1-yl]-6-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-4-yl]azetidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168833573 |
| Molecular Formula | C24H41N9O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | tert-butyl 4-[1-[2-[(2S)-2,4-dimethyl-1,4-diazepan-1-yl]-6-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-4-yl]azetidin-3-yl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C)CCCN1c1nc(/C(N)=N/O)cc(N2CC(N3CCN(C(=O)OC(C)(C)C)CC3)C2)n1 |
| InChI | InChI=1S/C24H41N9O3/c1-17-14-29(5)7-6-8-33(17)22-26-19(21(25)28-35)13-20(27-22)32-15-18(16-32)30-9-11-31(12-10-30)23(34)36-24(2,3)4/h13,17-18,35H,6-12,14-16H2,1-5H3,(H2,25,28)/t17-/m0/s1 |
| InChIKey | XBKRJNQJYFXWTG-KRWDZBQOSA-N |
| XLogP | 0.84 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|