C18H23BrF4N4O2 — CID 171506135
tert-butyl 4-[1-[3-bromo-6-fluoro-2-(trifluoromethyl)-4-pyridinyl]azetidin-3-yl]piperazine-1-carboxylate (PubChem CID 171506135) has the molecular formula C18H23BrF4N4O2 and a molecular weight of 483.30 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-bromo-6-fluoro-2-(trifluoromethyl)-4-pyridinyl]azetidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-bromo-6-fluoro-2-(trifluoromethyl)-4-pyridinyl]azetidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171506135 |
| Molecular Formula | C18H23BrF4N4O2 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | tert-butyl 4-[1-[3-bromo-6-fluoro-2-(trifluoromethyl)-4-pyridinyl]azetidin-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CN(c3cc(F)nc(C(F)(F)F)c3Br)C2)CC1 |
| InChI | InChI=1S/C18H23BrF4N4O2/c1-17(2,3)29-16(28)26-6-4-25(5-7-26)11-9-27(10-11)12-8-13(20)24-15(14(12)19)18(21,22)23/h8,11H,4-7,9-10H2,1-3H3 |
| InChIKey | VHAZUPZYFQDTHU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|