C15H21BrF3N3O2 — CID 155376177
tert-butyl 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 155376177) has the molecular formula C15H21BrF3N3O2 and a molecular weight of 412.25 g/mol. Its IUPAC name is tert-butyl 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155376177 |
| Molecular Formula | C15H21BrF3N3O2 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | tert-butyl 3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H21BrF3N3O2/c1-9-11(16)12(15(17,18)19)20-22(9)10-6-5-7-21(8-10)13(23)24-14(2,3)4/h10H,5-8H2,1-4H3 |
| InChIKey | GZUAHKDYJVWQFK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |