C15H23ClN4O3 — CID 88860765
tert-butyl 4-[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 88860765) has the molecular formula C15H23ClN4O3 and a molecular weight of 342.83 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88860765 |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | tert-butyl 4-[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | COCc1nc(Cl)cc(N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C15H23ClN4O3/c1-15(2,3)23-14(21)20-7-5-19(6-8-20)13-9-11(16)17-12(18-13)10-22-4/h9H,5-8,10H2,1-4H3 |
| InChIKey | GQECXKKKOSEYTD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |