C17H28FN3O2Sn — CID 178042562
tert-butyl 4-(4-fluoro-6-trimethylstannyl-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 178042562) has the molecular formula C17H28FN3O2Sn and a molecular weight of 444.14 g/mol. Its IUPAC name is tert-butyl 4-(4-fluoro-6-trimethylstannyl-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-fluoro-6-trimethylstannyl-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178042562 |
| Molecular Formula | C17H28FN3O2Sn |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | tert-butyl 4-(4-fluoro-6-trimethylstannyl-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(F)cc([Sn](C)(C)C)n2)CC1 |
| InChI | InChI=1S/C14H19FN3O2.3CH3.Sn/c1-14(2,3)20-13(19)18-8-6-17(7-9-18)12-10-11(15)4-5-16-12;;;;/h4,10H,6-9H2,1-3H3;3*1H3; |
| InChIKey | JRFBYFKYWBOWRC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |