C24H31ClN4O3 — CID 86672044
tert-butyl 4-[4-(2-chloro-6-morpholin-4-yl-4-pyridinyl)phenyl]piperazine-1-carboxylate (PubChem CID 86672044) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-chloro-6-morpholin-4-yl-4-pyridinyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-chloro-6-morpholin-4-yl-4-pyridinyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86672044 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | tert-butyl 4-[4-(2-chloro-6-morpholin-4-yl-4-pyridinyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-c3cc(Cl)nc(N4CCOCC4)c3)cc2)CC1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-24(2,3)32-23(30)29-10-8-27(9-11-29)20-6-4-18(5-7-20)19-16-21(25)26-22(17-19)28-12-14-31-15-13-28/h4-7,16-17H,8-15H2,1-3H3 |
| InChIKey | PBMGTCXRXOCNFC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|