C23H39N7O4 — CID 168833454
tert-butyl 4-[6-[(Z)-N'-hydroxycarbamimidoyl]-2-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-4-yl]-2,3-dimethylpiperazine-1-carboxylate (PubChem CID 168833454) has the molecular formula C23H39N7O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is tert-butyl 4-[6-[(Z)-N'-hydroxycarbamimidoyl]-2-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-4-yl]-2,3-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(Z)-N'-hydroxycarbamimidoyl]-2-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-4-yl]-2,3-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168833454 |
| Molecular Formula | C23H39N7O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | tert-butyl 4-[6-[(Z)-N'-hydroxycarbamimidoyl]-2-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-4-yl]-2,3-dimethylpiperazine-1-carboxylate |
| SMILES | CC1C(C)N(c2cc(/C(N)=N/O)nc(O[C@@H](C)[C@@H]3CCCN3C)n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39N7O4/c1-14-15(2)30(22(31)34-23(4,5)6)12-11-29(14)19-13-17(20(24)27-32)25-21(26-19)33-16(3)18-9-8-10-28(18)7/h13-16,18,32H,8-12H2,1-7H3,(H2,24,27)/t14?,15?,16-,18-/m0/s1 |
| InChIKey | PBEMHBOYDQILHO-OBQMCRIKSA-N |
| XLogP | 2.27 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|