C16H25N5O4 — CID 177290826
tert-butyl (2S)-2-[(1S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-2-yl]oxyethyl]pyrrolidine-1-carboxylate (PubChem CID 177290826) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-2-yl]oxyethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-2-yl]oxyethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177290826 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | tert-butyl (2S)-2-[(1S)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]pyrimidin-2-yl]oxyethyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](Oc1nccc(/C(N)=N/O)n1)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N5O4/c1-10(24-14-18-8-7-11(19-14)13(17)20-23)12-6-5-9-21(12)15(22)25-16(2,3)4/h7-8,10,12,23H,5-6,9H2,1-4H3,(H2,17,20)/t10-,12-/m0/s1 |
| InChIKey | FWRJJULIQTVLCS-JQWIXIFHSA-N |
| XLogP | 1.74 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|