C18H27N3O3 — CID 59128304
tert-butyl 4-[4-[acetyl(methyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 59128304) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 4-[4-[acetyl(methyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[acetyl(methyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59128304 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl 4-[4-[acetyl(methyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(=O)N(C)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O3/c1-14(22)19(5)15-6-8-16(9-7-15)20-10-12-21(13-11-20)17(23)24-18(2,3)4/h6-9H,10-13H2,1-5H3 |
| InChIKey | ODCNPXLCHLRQDS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|