C17H21ClI2N6O2 — CID 161346110
tert-butyl 4-(6-iodopyridazin-3-yl)piperazine-1-carboxylate;3-chloro-6-iodopyridazine (PubChem CID 161346110) has the molecular formula C17H21ClI2N6O2 and a molecular weight of 630.66 g/mol. Its IUPAC name is tert-butyl 4-(6-iodopyridazin-3-yl)piperazine-1-carboxylate;3-chloro-6-iodopyridazine.
| Compound Name | tert-butyl 4-(6-iodopyridazin-3-yl)piperazine-1-carboxylate;3-chloro-6-iodopyridazine |
|---|---|
| PubChem CID | 161346110 |
| Molecular Formula | C17H21ClI2N6O2 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 629.95 |
| IUPAC Name | tert-butyl 4-(6-iodopyridazin-3-yl)piperazine-1-carboxylate;3-chloro-6-iodopyridazine |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(I)nn2)CC1.Clc1ccc(I)nn1 |
| InChI | InChI=1S/C13H19IN4O2.C4H2ClIN2/c1-13(2,3)20-12(19)18-8-6-17(7-9-18)11-5-4-10(14)15-16-11;5-3-1-2-4(6)8-7-3/h4-5H,6-9H2,1-3H3;1-2H |
| InChIKey | VNHRDNZCLZAKMP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|