C19H23ClN6O6 — CID 156566035
tert-butyl 4-(5-nitro-2-pyridinyl)piperazine-1-carboxylate;2-chloro-5-nitropyridine (PubChem CID 156566035) has the molecular formula C19H23ClN6O6 and a molecular weight of 466.88 g/mol. Its IUPAC name is tert-butyl 4-(5-nitro-2-pyridinyl)piperazine-1-carboxylate;2-chloro-5-nitropyridine.
| Compound Name | tert-butyl 4-(5-nitro-2-pyridinyl)piperazine-1-carboxylate;2-chloro-5-nitropyridine |
|---|---|
| PubChem CID | 156566035 |
| Molecular Formula | C19H23ClN6O6 |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | tert-butyl 4-(5-nitro-2-pyridinyl)piperazine-1-carboxylate;2-chloro-5-nitropyridine |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H20N4O4.C5H3ClN2O2/c1-14(2,3)22-13(19)17-8-6-16(7-9-17)12-5-4-11(10-15-12)18(20)21;6-5-2-1-4(3-7-5)8(9)10/h4-5,10H,6-9H2,1-3H3;1-3H |
| InChIKey | WMXFIZXSKQTFDF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 144.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|