C15H18N4O5 — CID 7189106
trans-(1S,2S)-2-[4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid (PubChem CID 7189106) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 7189106 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | trans-(1S,2S)-2-[4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H]1C(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C15H18N4O5/c20-14(11-2-3-12(11)15(21)22)18-7-5-17(6-8-18)13-4-1-10(9-16-13)19(23)24/h1,4,9,11-12H,2-3,5-8H2,(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | IXMYIVNVIIYNMT-RYUDHWBXSA-N |
| XLogP | 0.75 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|