C13H17N3O4 — CID 125138651
methyl (3R,4S)-3-methyl-1-(5-nitro-2-pyridinyl)piperidine-4-carboxylate (PubChem CID 125138651) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl (3R,4S)-3-methyl-1-(5-nitro-2-pyridinyl)piperidine-4-carboxylate.
| Compound Name | methyl (3R,4S)-3-methyl-1-(5-nitro-2-pyridinyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 125138651 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl (3R,4S)-3-methyl-1-(5-nitro-2-pyridinyl)piperidine-4-carboxylate |
| SMILES | COC(=O)[C@H]1CCN(c2ccc([N+](=O)[O-])cn2)C[C@@H]1C |
| InChI | InChI=1S/C13H17N3O4/c1-9-8-15(6-5-11(9)13(17)20-2)12-4-3-10(7-14-12)16(18)19/h3-4,7,9,11H,5-6,8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | UBSJOUWYXDDDBU-ONGXEEELSA-N |
| XLogP | 1.63 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|