C15H22N4O4 — CID 97174632
tert-butyl N-[[(3R)-1-(5-nitro-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 97174632) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(5-nitro-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(5-nitro-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 97174632 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(5-nitro-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCN(c2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C15H22N4O4/c1-15(2,3)23-14(20)17-8-11-6-7-18(10-11)13-5-4-12(9-16-13)19(21)22/h4-5,9,11H,6-8,10H2,1-3H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | ASQXCQPQNRKVDQ-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|