C20H27ClN6O4 — CID 160904201
tert-butyl N-[[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate;2-chloro-5-nitropyridine (PubChem CID 160904201) has the molecular formula C20H27ClN6O4 and a molecular weight of 450.93 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate;2-chloro-5-nitropyridine.
| Compound Name | tert-butyl N-[[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate;2-chloro-5-nitropyridine |
|---|---|
| PubChem CID | 160904201 |
| Molecular Formula | C20H27ClN6O4 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | tert-butyl N-[[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]methyl]carbamate;2-chloro-5-nitropyridine |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2ccc(N)cn2)C1.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H24N4O2.C5H3ClN2O2/c1-15(2,3)21-14(20)18-8-11-6-7-19(10-11)13-5-4-12(16)9-17-13;6-5-2-1-4(3-7-5)8(9)10/h4-5,9,11H,6-8,10,16H2,1-3H3,(H,18,20);1-3H |
| InChIKey | SPXGXDNVUJADEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|