C20H26ClN5O2S — CID 167464944
tert-butyl N-[[(3R)-1-[5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 167464944) has the molecular formula C20H26ClN5O2S and a molecular weight of 435.98 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-[5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-[5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167464944 |
| Molecular Formula | C20H26ClN5O2S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | tert-butyl N-[[(3R)-1-[5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCN(c2cnc(Sc3cccc(N)c3Cl)cn2)C1 |
| InChI | InChI=1S/C20H26ClN5O2S/c1-20(2,3)28-19(27)25-9-13-7-8-26(12-13)16-10-24-17(11-23-16)29-15-6-4-5-14(22)18(15)21/h4-6,10-11,13H,7-9,12,22H2,1-3H3,(H,25,27)/t13-/m1/s1 |
| InChIKey | FRDAAHJKJFCGJQ-CYBMUJFWSA-N |
| XLogP | 4.21 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|