C11H15N3O3 — CID 2859766
[1-(5-nitro-2-pyridinyl)piperidin-3-yl]methanol (PubChem CID 2859766) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [1-(5-nitro-2-pyridinyl)piperidin-3-yl]methanol.
| Compound Name | [1-(5-nitro-2-pyridinyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 2859766 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [1-(5-nitro-2-pyridinyl)piperidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC(CO)C2)nc1 |
| InChI | InChI=1S/C11H15N3O3/c15-8-9-2-1-5-13(7-9)11-4-3-10(6-12-11)14(16)17/h3-4,6,9,15H,1-2,5,7-8H2 |
| InChIKey | JUHTWNDQTIGHFJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|