C9H13N3O3S — CID 102771576
[1-(5-nitro-1,3-thiazol-2-yl)piperidin-3-yl]methanol (PubChem CID 102771576) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is [1-(5-nitro-1,3-thiazol-2-yl)piperidin-3-yl]methanol.
| Compound Name | [1-(5-nitro-1,3-thiazol-2-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 102771576 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | [1-(5-nitro-1,3-thiazol-2-yl)piperidin-3-yl]methanol |
| SMILES | O=[N+]([O-])c1cnc(N2CCCC(CO)C2)s1 |
| InChI | InChI=1S/C9H13N3O3S/c13-6-7-2-1-3-11(5-7)9-10-4-8(16-9)12(14)15/h4,7,13H,1-3,5-6H2 |
| InChIKey | OVEDQHMYLYVTFW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|