C6H7N3O3S — CID 102771598
1-(5-nitro-1,3-thiazol-2-yl)azetidin-3-ol (PubChem CID 102771598) has the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. Its IUPAC name is 1-(5-nitro-1,3-thiazol-2-yl)azetidin-3-ol.
| Compound Name | 1-(5-nitro-1,3-thiazol-2-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 102771598 |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 1-(5-nitro-1,3-thiazol-2-yl)azetidin-3-ol |
| SMILES | O=[N+]([O-])c1cnc(N2CC(O)C2)s1 |
| InChI | InChI=1S/C6H7N3O3S/c10-4-2-8(3-4)6-7-1-5(13-6)9(11)12/h1,4,10H,2-3H2 |
| InChIKey | UARNMOZSMJMHME-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|