C8H8N4O3S — CID 102770047
4-(5-nitro-1,3-thiazol-2-yl)morpholine-2-carbonitrile (PubChem CID 102770047) has the molecular formula C8H8N4O3S and a molecular weight of 240.24 g/mol. Its IUPAC name is 4-(5-nitro-1,3-thiazol-2-yl)morpholine-2-carbonitrile.
| Compound Name | 4-(5-nitro-1,3-thiazol-2-yl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 102770047 |
| Molecular Formula | C8H8N4O3S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-(5-nitro-1,3-thiazol-2-yl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(c2ncc([N+](=O)[O-])s2)CCO1 |
| InChI | InChI=1S/C8H8N4O3S/c9-3-6-5-11(1-2-15-6)8-10-4-7(16-8)12(13)14/h4,6H,1-2,5H2 |
| InChIKey | MVVUOJMWDNYETI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|